C15H12F3N3O4 — CID 17479833
N-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 17479833) has the molecular formula C15H12F3N3O4 and a molecular weight of 355.27 g/mol. Its IUPAC name is N-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 17479833 |
| Molecular Formula | C15H12F3N3O4 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CN1C(=O)C(=Cc2cccc(NC(=O)C(F)(F)F)c2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C15H12F3N3O4/c1-20-11(22)10(12(23)21(2)14(20)25)7-8-4-3-5-9(6-8)19-13(24)15(16,17)18/h3-7H,1-2H3,(H,19,24) |
| InChIKey | FGTGAPOEVQZVAJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|