C10H8F3NO2 — CID 87575874
2,2,3-trifluoro-N-(3-formylphenyl)propanamide (PubChem CID 87575874) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 2,2,3-trifluoro-N-(3-formylphenyl)propanamide.
| Compound Name | 2,2,3-trifluoro-N-(3-formylphenyl)propanamide |
|---|---|
| PubChem CID | 87575874 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2,2,3-trifluoro-N-(3-formylphenyl)propanamide |
| SMILES | O=Cc1cccc(NC(=O)C(F)(F)CF)c1 |
| InChI | InChI=1S/C10H8F3NO2/c11-6-10(12,13)9(16)14-8-3-1-2-7(4-8)5-15/h1-5H,6H2,(H,14,16) |
| InChIKey | GSMNJHXGOWPTGG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|