C20H15F3N2O4 — CID 46697139
N-[3-[(Z)-[2-(2-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 46697139) has the molecular formula C20H15F3N2O4 and a molecular weight of 404.34 g/mol. Its IUPAC name is N-[3-[(Z)-[2-(2-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(Z)-[2-(2-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 46697139 |
| Molecular Formula | C20H15F3N2O4 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[3-[(Z)-[2-(2-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CCOc1ccccc1C1=N/C(=C\c2cccc(NC(=O)C(F)(F)F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H15F3N2O4/c1-2-28-16-9-4-3-8-14(16)17-25-15(18(26)29-17)11-12-6-5-7-13(10-12)24-19(27)20(21,22)23/h3-11H,2H2,1H3,(H,24,27)/b15-11- |
| InChIKey | NPZRUQFETNELDX-PTNGSMBKSA-N |
| XLogP | 3.93 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|