C22H14F3NO2 — CID 90251358
2,2,2-trifluoro-N-[(9E)-9-[(2-hydroxyphenyl)methylidene]fluoren-2-yl]acetamide (PubChem CID 90251358) has the molecular formula C22H14F3NO2 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(9E)-9-[(2-hydroxyphenyl)methylidene]fluoren-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(9E)-9-[(2-hydroxyphenyl)methylidene]fluoren-2-yl]acetamide |
|---|---|
| PubChem CID | 90251358 |
| Molecular Formula | C22H14F3NO2 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[(9E)-9-[(2-hydroxyphenyl)methylidene]fluoren-2-yl]acetamide |
| SMILES | O=C(Nc1ccc2c(c1)/C(=C/c1ccccc1O)c1ccccc1-2)C(F)(F)F |
| InChI | InChI=1S/C22H14F3NO2/c23-22(24,25)21(28)26-14-9-10-17-15-6-2-3-7-16(15)18(19(17)12-14)11-13-5-1-4-8-20(13)27/h1-12,27H,(H,26,28)/b18-11+ |
| InChIKey | VCXHRCODVGIMJI-WOJGMQOQSA-N |
| XLogP | 5.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|