C16H12O5 — CID 175378846
4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one (PubChem CID 175378846) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one.
| Compound Name | 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 175378846 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one |
| SMILES | O=C1C(=Cc2cc(O)c(O)c(O)c2)Cc2c(O)cccc21 |
| InChI | InChI=1S/C16H12O5/c17-12-3-1-2-10-11(12)7-9(15(10)20)4-8-5-13(18)16(21)14(19)6-8/h1-6,17-19,21H,7H2 |
| InChIKey | BZGZQRZEJBGEHY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|