About 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one
4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one (PubChem CID 175378846) has the molecular formula C16H12O5
and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one.
Molecular Properties
| Compound Name | 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one |
| PubChem CID | 175378846 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one |
| SMILES | O=C1C(=Cc2cc(O)c(O)c(O)c2)Cc2c(O)cccc21 |
| InChI | InChI=1S/C16H12O5/c17-12-3-1-2-10-11(12)7-9(15(10)20)4-8-5-13(18)16(21)14(19)6-8/h1-6,17-19,21H,7H2 |
| InChIKey | BZGZQRZEJBGEHY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one?
The IUPAC name of 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one (CID 175378846) is 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one.
What is the SMILES notation for 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one?
The canonical SMILES for 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one is O=C1C(=Cc2cc(O)c(O)c(O)c2)Cc2c(O)cccc21.
What is the InChIKey of 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one?
The InChIKey is BZGZQRZEJBGEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O5/c17-12-3-1-2-10-11(12)7-9(15(10)20)4-8-5-13(18)16(21)14(19)6-8/h1-6,17-19,21H,7H2.
What are the key properties of 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one?
4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one has a molecular weight of 284.27 g/mol, XLogP of 2.33, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-[(3,4,5-trihydroxyphenyl)methylidene]-3H-inden-1-one is sourced from PubChem (CID 175378846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).