C19H13BrClNO6S — CID 2902248
2-[5-bromo-4-[[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 2902248) has the molecular formula C19H13BrClNO6S and a molecular weight of 498.74 g/mol. Its IUPAC name is 2-[5-bromo-4-[[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[5-bromo-4-[[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 2902248 |
| Molecular Formula | C19H13BrClNO6S |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 496.93 |
| IUPAC Name | 2-[5-bromo-4-[[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C=C2SC(=O)N(c3ccc(Cl)cc3)C2=O)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C19H13BrClNO6S/c1-27-14-6-10(13(20)8-15(14)28-9-17(23)24)7-16-18(25)22(19(26)29-16)12-4-2-11(21)3-5-12/h2-8H,9H2,1H3,(H,23,24) |
| InChIKey | WNHWUHTYDYQDSO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|