C26H22N4O2 — CID 92519631
(Z)-3-[1-benzyl-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile (PubChem CID 92519631) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is (Z)-3-[1-benzyl-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile.
| Compound Name | (Z)-3-[1-benzyl-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 92519631 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (Z)-3-[1-benzyl-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile |
| SMILES | COc1ccc(-c2nn(Cc3ccccc3)cc2/C=C(\C#N)c2ccccn2)cc1OC |
| InChI | InChI=1S/C26H22N4O2/c1-31-24-12-11-20(15-25(24)32-2)26-22(14-21(16-27)23-10-6-7-13-28-23)18-30(29-26)17-19-8-4-3-5-9-19/h3-15,18H,17H2,1-2H3/b21-14+ |
| InChIKey | GFKRMUBYGNQVIT-KGENOOAVSA-N |
| XLogP | 5.07 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|