C29H25FN4O3 — CID 23099681
(E)-2-cyano-3-[3-(3,4-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-N-(2-methylphenyl)prop-2-enamide (PubChem CID 23099681) has the molecular formula C29H25FN4O3 and a molecular weight of 496.54 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-(3,4-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-(3,4-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 23099681 |
| Molecular Formula | C29H25FN4O3 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (E)-2-cyano-3-[3-(3,4-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-N-(2-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(-c2nn(Cc3ccc(F)cc3)cc2/C=C(\C#N)C(=O)Nc2ccccc2C)cc1OC |
| InChI | InChI=1S/C29H25FN4O3/c1-19-6-4-5-7-25(19)32-29(35)22(16-31)14-23-18-34(17-20-8-11-24(30)12-9-20)33-28(23)21-10-13-26(36-2)27(15-21)37-3/h4-15,18H,17H2,1-3H3,(H,32,35)/b22-14+ |
| InChIKey | LTRKWKJXWOYWJB-HYARGMPZSA-N |
| XLogP | 5.61 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|