C28H23FN4O5S — CID 17280552
methyl 2-[[(E)-2-cyano-3-[3-(3,4-dimethoxyphenyl)-1-[(2-fluorophenyl)methyl]pyrazol-4-yl]prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 17280552) has the molecular formula C28H23FN4O5S and a molecular weight of 546.58 g/mol. Its IUPAC name is methyl 2-[[(E)-2-cyano-3-[3-(3,4-dimethoxyphenyl)-1-[(2-fluorophenyl)methyl]pyrazol-4-yl]prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-2-cyano-3-[3-(3,4-dimethoxyphenyl)-1-[(2-fluorophenyl)methyl]pyrazol-4-yl]prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17280552 |
| Molecular Formula | C28H23FN4O5S |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | methyl 2-[[(E)-2-cyano-3-[3-(3,4-dimethoxyphenyl)-1-[(2-fluorophenyl)methyl]pyrazol-4-yl]prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)/C(C#N)=C/c1cn(Cc2ccccc2F)nc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H23FN4O5S/c1-36-23-9-8-17(13-24(23)37-2)25-20(16-33(32-25)15-18-6-4-5-7-22(18)29)12-19(14-30)26(34)31-27-21(10-11-39-27)28(35)38-3/h4-13,16H,15H2,1-3H3,(H,31,34)/b19-12+ |
| InChIKey | PCTAXGIXRUNTDC-XDHOZWIPSA-N |
| XLogP | 5.15 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|