C17H17ClN2O5 — CID 9477620
[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate (PubChem CID 9477620) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate.
| Compound Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 9477620 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate |
| SMILES | NC(=O)C1CCN(C(=O)COC(=O)c2cc3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C17H17ClN2O5/c18-12-1-2-13-11(7-12)8-14(25-13)17(23)24-9-15(21)20-5-3-10(4-6-20)16(19)22/h1-2,7-8,10H,3-6,9H2,(H2,19,22) |
| InChIKey | KONIMPHRWAQJMB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |