C24H21N3O3S — CID 30463145
3-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]chromen-2-one (PubChem CID 30463145) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 30463145 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCN(Cc2csc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C24H21N3O3S/c28-23(20-14-18-8-4-5-9-21(18)30-24(20)29)27-12-10-26(11-13-27)15-19-16-31-22(25-19)17-6-2-1-3-7-17/h1-9,14,16H,10-13,15H2 |
| InChIKey | WKPQNUJNNBJKFM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|