C22H24N2O4S — CID 110828562
2-[4-(azepan-1-ylsulfonyl)anilino]-1-(1-benzofuran-2-yl)ethanone (PubChem CID 110828562) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[4-(azepan-1-ylsulfonyl)anilino]-1-(1-benzofuran-2-yl)ethanone.
| Compound Name | 2-[4-(azepan-1-ylsulfonyl)anilino]-1-(1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 110828562 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[4-(azepan-1-ylsulfonyl)anilino]-1-(1-benzofuran-2-yl)ethanone |
| SMILES | O=C(CNc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H24N2O4S/c25-20(22-15-17-7-3-4-8-21(17)28-22)16-23-18-9-11-19(12-10-18)29(26,27)24-13-5-1-2-6-14-24/h3-4,7-12,15,23H,1-2,5-6,13-14,16H2 |
| InChIKey | YQRVBUGYZIICKK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |