C22H20N2O2 — CID 23965037
3-methyl-N-(2-naphthalen-2-yl-1,3-benzoxazol-5-yl)butanamide (PubChem CID 23965037) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-methyl-N-(2-naphthalen-2-yl-1,3-benzoxazol-5-yl)butanamide.
| Compound Name | 3-methyl-N-(2-naphthalen-2-yl-1,3-benzoxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 23965037 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-methyl-N-(2-naphthalen-2-yl-1,3-benzoxazol-5-yl)butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc2oc(-c3ccc4ccccc4c3)nc2c1 |
| InChI | InChI=1S/C22H20N2O2/c1-14(2)11-21(25)23-18-9-10-20-19(13-18)24-22(26-20)17-8-7-15-5-3-4-6-16(15)12-17/h3-10,12-14H,11H2,1-2H3,(H,23,25) |
| InChIKey | LGAQSROKGFMIEH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |