C21H24N2O2 — CID 23766038
3-methyl-N-[3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]butanamide (PubChem CID 23766038) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-methyl-N-[3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]butanamide.
| Compound Name | 3-methyl-N-[3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 23766038 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-methyl-N-[3-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1cccc(-c2nc3cc(C(C)C)ccc3o2)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-13(2)10-20(24)22-17-7-5-6-16(11-17)21-23-18-12-15(14(3)4)8-9-19(18)25-21/h5-9,11-14H,10H2,1-4H3,(H,22,24) |
| InChIKey | ABPFTDNCQDEMOO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |