C25H26ClN3O3 — CID 142715827
3-[4-[6-[(6-chloro-3-pyridinyl)oxy]-1,3-benzoxazol-2-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 142715827) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is 3-[4-[6-[(6-chloro-3-pyridinyl)oxy]-1,3-benzoxazol-2-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[6-[(6-chloro-3-pyridinyl)oxy]-1,3-benzoxazol-2-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 142715827 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[4-[6-[(6-chloro-3-pyridinyl)oxy]-1,3-benzoxazol-2-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(-c2nc3ccc(Oc4ccc(Cl)nc4)cc3o2)cc1 |
| InChI | InChI=1S/C25H26ClN3O3/c1-3-29(4-2)14-5-15-30-19-8-6-18(7-9-19)25-28-22-12-10-20(16-23(22)32-25)31-21-11-13-24(26)27-17-21/h6-13,16-17H,3-5,14-15H2,1-2H3 |
| InChIKey | OQMBSZUDUIFCOE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|