C21H13F3N2O4 — CID 142715991
[4-[6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-1,3-benzoxazol-2-yl]phenyl] acetate (PubChem CID 142715991) has the molecular formula C21H13F3N2O4 and a molecular weight of 414.34 g/mol. Its IUPAC name is [4-[6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-1,3-benzoxazol-2-yl]phenyl] acetate.
| Compound Name | [4-[6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-1,3-benzoxazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 142715991 |
| Molecular Formula | C21H13F3N2O4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [4-[6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-1,3-benzoxazol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2nc3ccc(Oc4ccc(C(F)(F)F)nc4)cc3o2)cc1 |
| InChI | InChI=1S/C21H13F3N2O4/c1-12(27)28-14-4-2-13(3-5-14)20-26-17-8-6-15(10-18(17)30-20)29-16-7-9-19(25-11-16)21(22,23)24/h2-11H,1H3 |
| InChIKey | URESPNOOZJWCJA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|