C22H14F3NO4 — CID 142715984
[4-[6-[3-(trifluoromethyl)phenoxy]-1,3-benzoxazol-2-yl]phenyl] acetate (PubChem CID 142715984) has the molecular formula C22H14F3NO4 and a molecular weight of 413.35 g/mol. Its IUPAC name is [4-[6-[3-(trifluoromethyl)phenoxy]-1,3-benzoxazol-2-yl]phenyl] acetate.
| Compound Name | [4-[6-[3-(trifluoromethyl)phenoxy]-1,3-benzoxazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 142715984 |
| Molecular Formula | C22H14F3NO4 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [4-[6-[3-(trifluoromethyl)phenoxy]-1,3-benzoxazol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2nc3ccc(Oc4cccc(C(F)(F)F)c4)cc3o2)cc1 |
| InChI | InChI=1S/C22H14F3NO4/c1-13(27)28-16-7-5-14(6-8-16)21-26-19-10-9-18(12-20(19)30-21)29-17-4-2-3-15(11-17)22(23,24)25/h2-12H,1H3 |
| InChIKey | PRVXINIZJXTOBO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|