C22H13Cl2NO3 — CID 46496427
(E)-3-(2,3-dichlorophenyl)-N-(3-oxobenzo[f]chromen-2-yl)prop-2-enamide (PubChem CID 46496427) has the molecular formula C22H13Cl2NO3 and a molecular weight of 410.26 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-(3-oxobenzo[f]chromen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-(3-oxobenzo[f]chromen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46496427 |
| Molecular Formula | C22H13Cl2NO3 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-(3-oxobenzo[f]chromen-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)Nc1cc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C22H13Cl2NO3/c23-17-7-3-5-14(21(17)24)9-11-20(26)25-18-12-16-15-6-2-1-4-13(15)8-10-19(16)28-22(18)27/h1-12H,(H,25,26)/b11-9+ |
| InChIKey | FIRUTIXCGXFSDV-PKNBQFBNSA-N |
| XLogP | 5.90 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|