C19H12N4O3 — CID 143844190
N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]pyrazine-2-carboxamide (PubChem CID 143844190) has the molecular formula C19H12N4O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143844190 |
| Molecular Formula | C19H12N4O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2c(=O)o1)c1cnccn1 |
| InChI | InChI=1S/C19H12N4O3/c24-17(16-11-20-9-10-21-16)22-14-7-3-1-5-12(14)18-23-15-8-4-2-6-13(15)19(25)26-18/h1-11H,(H,22,24) |
| InChIKey | ZLIFUGCHGFMFTK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |