C25H17N3O3 — CID 143844182
N-[5-amino-2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-carboxamide (PubChem CID 143844182) has the molecular formula C25H17N3O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[5-amino-2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[5-amino-2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 143844182 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[5-amino-2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-carboxamide |
| SMILES | Nc1ccc(-c2nc3ccccc3c(=O)o2)c(NC(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C25H17N3O3/c26-18-11-12-19(24-28-21-8-4-3-7-20(21)25(30)31-24)22(14-18)27-23(29)17-10-9-15-5-1-2-6-16(15)13-17/h1-14H,26H2,(H,27,29) |
| InChIKey | AVWYSKHLTTZKSR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|