About S-isoquinolin-6-yl ethanethioate
S-isoquinolin-6-yl ethanethioate (PubChem CID 86187053) has the molecular formula C11H9NOS
and a molecular weight of 203.27 g/mol. Its IUPAC name is S-isoquinolin-6-yl ethanethioate.
Molecular Properties
| Compound Name | S-isoquinolin-6-yl ethanethioate |
| PubChem CID | 86187053 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | S-isoquinolin-6-yl ethanethioate |
| SMILES | CC(=O)Sc1ccc2cnccc2c1 |
| InChI | InChI=1S/C11H9NOS/c1-8(13)14-11-3-2-10-7-12-5-4-9(10)6-11/h2-7H,1H3 |
| InChIKey | XMJPOCSWIJAFCG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-isoquinolin-6-yl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-isoquinolin-6-yl ethanethioate?
The IUPAC name of S-isoquinolin-6-yl ethanethioate (CID 86187053) is S-isoquinolin-6-yl ethanethioate.
What is the SMILES notation for S-isoquinolin-6-yl ethanethioate?
The canonical SMILES for S-isoquinolin-6-yl ethanethioate is CC(=O)Sc1ccc2cnccc2c1.
What is the InChIKey of S-isoquinolin-6-yl ethanethioate?
The InChIKey is XMJPOCSWIJAFCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NOS/c1-8(13)14-11-3-2-10-7-12-5-4-9(10)6-11/h2-7H,1H3.
What are the key properties of S-isoquinolin-6-yl ethanethioate?
S-isoquinolin-6-yl ethanethioate has a molecular weight of 203.27 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-isoquinolin-6-yl ethanethioate is sourced from PubChem (CID 86187053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).