C8H5F3OS — CID 91657158
S-(3,4,5-trifluorophenyl) ethanethioate (PubChem CID 91657158) has the molecular formula C8H5F3OS and a molecular weight of 206.19 g/mol. Its IUPAC name is S-(3,4,5-trifluorophenyl) ethanethioate.
| Compound Name | S-(3,4,5-trifluorophenyl) ethanethioate |
|---|---|
| PubChem CID | 91657158 |
| Molecular Formula | C8H5F3OS |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | S-(3,4,5-trifluorophenyl) ethanethioate |
| SMILES | CC(=O)Sc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C8H5F3OS/c1-4(12)13-5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
| InChIKey | UJFOPJARSSBLCN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|