C9H7ClN2O4S — CID 63665376
4-amino-2-(chloromethylsulfonyl)isoindole-1,3-dione (PubChem CID 63665376) has the molecular formula C9H7ClN2O4S and a molecular weight of 274.68 g/mol. Its IUPAC name is 4-amino-2-(chloromethylsulfonyl)isoindole-1,3-dione.
| Compound Name | 4-amino-2-(chloromethylsulfonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 63665376 |
| Molecular Formula | C9H7ClN2O4S |
| Molecular Weight | 274.68 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 4-amino-2-(chloromethylsulfonyl)isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(S(=O)(=O)CCl)C2=O |
| InChI | InChI=1S/C9H7ClN2O4S/c10-4-17(15,16)12-8(13)5-2-1-3-6(11)7(5)9(12)14/h1-3H,4,11H2 |
| InChIKey | SUFXPDFBJYCUBQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.68 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|