C11H10N2O6S — CID 61454907
2-(4-amino-1,3-dioxoisoindol-2-yl)sulfonylpropanoic acid (PubChem CID 61454907) has the molecular formula C11H10N2O6S and a molecular weight of 298.28 g/mol. Its IUPAC name is 2-(4-amino-1,3-dioxoisoindol-2-yl)sulfonylpropanoic acid.
| Compound Name | 2-(4-amino-1,3-dioxoisoindol-2-yl)sulfonylpropanoic acid |
|---|---|
| PubChem CID | 61454907 |
| Molecular Formula | C11H10N2O6S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(4-amino-1,3-dioxoisoindol-2-yl)sulfonylpropanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C11H10N2O6S/c1-5(11(16)17)20(18,19)13-9(14)6-3-2-4-7(12)8(6)10(13)15/h2-5H,12H2,1H3,(H,16,17) |
| InChIKey | MFIRWJKHSZSYNF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|