C12H10N2O3 — CID 97305211
4-amino-2-[(Z)-but-2-enoyl]isoindole-1,3-dione (PubChem CID 97305211) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 4-amino-2-[(Z)-but-2-enoyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(Z)-but-2-enoyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 97305211 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-amino-2-[(Z)-but-2-enoyl]isoindole-1,3-dione |
| SMILES | C/C=C\C(=O)N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C12H10N2O3/c1-2-4-9(15)14-11(16)7-5-3-6-8(13)10(7)12(14)17/h2-6H,13H2,1H3/b4-2- |
| InChIKey | NMXNOJGVNMWATH-RQOWECAXSA-N |
| XLogP | 0.97 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|