C14H12N2O5 — CID 76993073
4-(4-amino-1,3-dioxoisoindol-2-yl)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76993073) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-(4-amino-1,3-dioxoisoindol-2-yl)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(4-amino-1,3-dioxoisoindol-2-yl)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76993073 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-(4-amino-1,3-dioxoisoindol-2-yl)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C14H12N2O5/c1-6(7(2)14(20)21)11(17)16-12(18)8-4-3-5-9(15)10(8)13(16)19/h3-5H,15H2,1-2H3,(H,20,21) |
| InChIKey | QOOUVEKRDIIGGS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|