C15H19N3O3 — CID 43702480
4-amino-2-(7-aminoheptanoyl)isoindole-1,3-dione (PubChem CID 43702480) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-amino-2-(7-aminoheptanoyl)isoindole-1,3-dione.
| Compound Name | 4-amino-2-(7-aminoheptanoyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 43702480 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-amino-2-(7-aminoheptanoyl)isoindole-1,3-dione |
| SMILES | NCCCCCCC(=O)N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C15H19N3O3/c16-9-4-2-1-3-8-12(19)18-14(20)10-6-5-7-11(17)13(10)15(18)21/h5-7H,1-4,8-9,16-17H2 |
| InChIKey | AAWKBUYMRCPXDM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|