C13H15N3O3 — CID 54879111
3-(4-amino-1,3-dioxoisoindol-2-yl)-N,N-dimethylpropanamide (PubChem CID 54879111) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-(4-amino-1,3-dioxoisoindol-2-yl)-N,N-dimethylpropanamide.
| Compound Name | 3-(4-amino-1,3-dioxoisoindol-2-yl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 54879111 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-(4-amino-1,3-dioxoisoindol-2-yl)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCN1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C13H15N3O3/c1-15(2)10(17)6-7-16-12(18)8-4-3-5-9(14)11(8)13(16)19/h3-5H,6-7,14H2,1-2H3 |
| InChIKey | DBSRKGQLFPECKA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|