C18H15FN2O3 — CID 94626265
3-(1,3-dioxoisoindol-2-yl)-N-(4-fluorophenyl)-N-methylpropanamide (PubChem CID 94626265) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(4-fluorophenyl)-N-methylpropanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(4-fluorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 94626265 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(4-fluorophenyl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCN1C(=O)c2ccccc2C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2O3/c1-20(13-8-6-12(19)7-9-13)16(22)10-11-21-17(23)14-4-2-3-5-15(14)18(21)24/h2-9H,10-11H2,1H3 |
| InChIKey | ZLAUGFFHEBAZHJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|