C14H15FN2O3 — CID 94626292
3-(2,5-dioxopyrrolidin-1-yl)-N-(4-fluorophenyl)-N-methylpropanamide (PubChem CID 94626292) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-fluorophenyl)-N-methylpropanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-fluorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 94626292 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-fluorophenyl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCN1C(=O)CCC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2O3/c1-16(11-4-2-10(15)3-5-11)12(18)8-9-17-13(19)6-7-14(17)20/h2-5H,6-9H2,1H3 |
| InChIKey | RINALRQZFXSMOP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|