About ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate
ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate (PubChem CID 143044451) has the molecular formula C12H16FNOS2
and a molecular weight of 273.40 g/mol. Its IUPAC name is ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate.
Molecular Properties
| Compound Name | ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate |
| PubChem CID | 143044451 |
| Molecular Formula | C12H16FNOS2 |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate |
| SMILES | CC.CN(C(=O)CSC=S)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FNOS2.C2H6/c1-12(10(13)6-15-7-14)9-4-2-8(11)3-5-9;1-2/h2-5,7H,6H2,1H3;1-2H3 |
| InChIKey | PSIMPBSENSQROS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate?
The IUPAC name of ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate (CID 143044451) is ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate.
What is the SMILES notation for ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate?
The canonical SMILES for ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate is CC.CN(C(=O)CSC=S)c1ccc(F)cc1.
What is the InChIKey of ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate?
The InChIKey is PSIMPBSENSQROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNOS2.C2H6/c1-12(10(13)6-15-7-14)9-4-2-8(11)3-5-9;1-2/h2-5,7H,6H2,1H3;1-2H3.
What are the key properties of ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate?
ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate has a molecular weight of 273.40 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[2-(4-fluoro-N-methylanilino)-2-oxoethyl] methanedithioate is sourced from PubChem (CID 143044451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).