C13H15N3O3 — CID 61178517
4-amino-2-[(2S)-2-amino-3-methylbutanoyl]isoindole-1,3-dione (PubChem CID 61178517) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-amino-2-[(2S)-2-amino-3-methylbutanoyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(2S)-2-amino-3-methylbutanoyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 61178517 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-amino-2-[(2S)-2-amino-3-methylbutanoyl]isoindole-1,3-dione |
| SMILES | CC(C)[C@H](N)C(=O)N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C13H15N3O3/c1-6(2)10(15)13(19)16-11(17)7-4-3-5-8(14)9(7)12(16)18/h3-6,10H,14-15H2,1-2H3/t10-/m0/s1 |
| InChIKey | ZYTLFKZFNZEUHG-JTQLQIEISA-N |
| XLogP | 0.37 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|