C11H11N3O3 — CID 43421958
2-(4-amino-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 43421958) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-(4-amino-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | 2-(4-amino-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 43421958 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-(4-amino-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C(N)=O)N1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C11H11N3O3/c1-5(9(13)15)14-10(16)6-3-2-4-7(12)8(6)11(14)17/h2-5H,12H2,1H3,(H2,13,15) |
| InChIKey | HKOGOZZAJAVRKH-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|