C20H21N3O5S — CID 7858166
2-[(2S)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylsulfanylpropanoyl]-4-aminoisoindole-1,3-dione (PubChem CID 7858166) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[(2S)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylsulfanylpropanoyl]-4-aminoisoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylsulfanylpropanoyl]-4-aminoisoindole-1,3-dione |
|---|---|
| PubChem CID | 7858166 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-[(2S)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylsulfanylpropanoyl]-4-aminoisoindole-1,3-dione |
| SMILES | CSC[C@H](C(=O)N1C(=O)c2cccc(N)c2C1=O)N1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C20H21N3O5S/c1-29-9-14(22-16(24)10-5-2-3-6-11(10)17(22)25)19(27)23-18(26)12-7-4-8-13(21)15(12)20(23)28/h4,7-8,10-11,14H,2-3,5-6,9,21H2,1H3/t10-,11-,14-/m1/s1 |
| InChIKey | BVOKSQCWOFKQOE-JTNHKYCSSA-N |
| XLogP | 1.30 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|