C18H29N3O3S — CID 119491952
2-[1-[3-(methylamino)piperidin-1-yl]-3-methylsulfanyl-1-oxopropan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 119491952) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-[1-[3-(methylamino)piperidin-1-yl]-3-methylsulfanyl-1-oxopropan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[1-[3-(methylamino)piperidin-1-yl]-3-methylsulfanyl-1-oxopropan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 119491952 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[1-[3-(methylamino)piperidin-1-yl]-3-methylsulfanyl-1-oxopropan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CNC1CCCN(C(=O)C(CSC)N2C(=O)C3CCCCC3C2=O)C1 |
| InChI | InChI=1S/C18H29N3O3S/c1-19-12-6-5-9-20(10-12)18(24)15(11-25-2)21-16(22)13-7-3-4-8-14(13)17(21)23/h12-15,19H,3-11H2,1-2H3 |
| InChIKey | YXJDNGYBOMFUQQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|