C12H16NO4S- — CID 2376050
(2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylsulfanylpropanoate (PubChem CID 2376050) has the molecular formula C12H16NO4S- and a molecular weight of 270.33 g/mol. Its IUPAC name is (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylsulfanylpropanoate.
| Compound Name | (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 2376050 |
| Molecular Formula | C12H16NO4S- |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-methylsulfanylpropanoate |
| SMILES | CSC[C@@H](C(=O)[O-])N1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C12H17NO4S/c1-18-6-9(12(16)17)13-10(14)7-4-2-3-5-8(7)11(13)15/h7-9H,2-6H2,1H3,(H,16,17)/p-1/t7-,8+,9-/m0/s1 |
| InChIKey | VUSVLCRDPBARIH-YIZRAAEISA-M |
| XLogP | -0.36 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|