C21H26N2O4S — CID 51531916
(2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3-acetylphenyl)-4-methylsulfanylbutanamide (PubChem CID 51531916) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3-acetylphenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3-acetylphenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 51531916 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3-acetylphenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](C(=O)Nc1cccc(C(C)=O)c1)N1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C21H26N2O4S/c1-13(24)14-6-5-7-15(12-14)22-19(25)18(10-11-28-2)23-20(26)16-8-3-4-9-17(16)21(23)27/h5-7,12,16-18H,3-4,8-11H2,1-2H3,(H,22,25)/t16-,17+,18-/m1/s1 |
| InChIKey | YJUNABWBIVRHDU-FGTMMUONSA-N |
| XLogP | 3.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|