C23H30N2O6S — CID 55615395
ethyl 2-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]phenoxy]acetate (PubChem CID 55615395) has the molecular formula C23H30N2O6S and a molecular weight of 462.57 g/mol. Its IUPAC name is ethyl 2-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 55615395 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | ethyl 2-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NC(=O)C(CCSC)N2C(=O)C3CCCCC3C2=O)c1 |
| InChI | InChI=1S/C23H30N2O6S/c1-3-30-20(26)14-31-16-8-6-7-15(13-16)24-21(27)19(11-12-32-2)25-22(28)17-9-4-5-10-18(17)23(25)29/h6-8,13,17-19H,3-5,9-12,14H2,1-2H3,(H,24,27) |
| InChIKey | OWXJJNSECOXWBZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|