C23H29N3O4S — CID 98397832
N-[3-[[(2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-4-methylsulfanylbutanoyl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 98397832) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[3-[[(2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-4-methylsulfanylbutanoyl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[(2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-4-methylsulfanylbutanoyl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 98397832 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[3-[[(2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-4-methylsulfanylbutanoyl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | CSCC[C@H](C(=O)Nc1cccc(NC(=O)C2CC2)c1)N1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C23H29N3O4S/c1-31-12-11-19(26-22(29)17-7-2-3-8-18(17)23(26)30)21(28)25-16-6-4-5-15(13-16)24-20(27)14-9-10-14/h4-6,13-14,17-19H,2-3,7-12H2,1H3,(H,24,27)(H,25,28)/t17-,18+,19-/m1/s1 |
| InChIKey | TUIAVEMORXUEKY-CEXWTWQISA-N |
| XLogP | 3.27 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|