C20H22ClN3O3S3 — CID 24509131
N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 24509131) has the molecular formula C20H22ClN3O3S3 and a molecular weight of 484.07 g/mol. Its IUPAC name is N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 24509131 |
| Molecular Formula | C20H22ClN3O3S3 |
| Molecular Weight | 484.07 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(C(=O)Nc1nc(-c2ccc(Cl)s2)cs1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C20H22ClN3O3S3/c1-28-9-8-14(24-18(26)11-4-2-3-5-12(11)19(24)27)17(25)23-20-22-13(10-29-20)15-6-7-16(21)30-15/h6-7,10-12,14H,2-5,8-9H2,1H3,(H,22,23,25) |
| InChIKey | OTJYBKGLOPFKRM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.07 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|