C21H24N4O3S2 — CID 55432952
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 55432952) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 55432952 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CSCCC(C(=O)Nc1nnc(-c2ccccc2)s1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C21H24N4O3S2/c1-29-12-11-16(25-19(27)14-9-5-6-10-15(14)20(25)28)17(26)22-21-24-23-18(30-21)13-7-3-2-4-8-13/h2-4,7-8,14-16H,5-6,9-12H2,1H3,(H,22,24,26) |
| InChIKey | YVBAIXCVMPXWLM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|