C21H25F3N2O3S — CID 55433580
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 55433580) has the molecular formula C21H25F3N2O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55433580 |
| Molecular Formula | C21H25F3N2O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | CSCCC(C(=O)NCc1cccc(C(F)(F)F)c1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C21H25F3N2O3S/c1-30-10-9-17(26-19(28)15-7-2-3-8-16(15)20(26)29)18(27)25-12-13-5-4-6-14(11-13)21(22,23)24/h4-6,11,15-17H,2-3,7-10,12H2,1H3,(H,25,27) |
| InChIKey | UMGQOMQWTLLXIK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|