C27H30N2O5S — CID 55433524
[3-(benzylcarbamoyl)phenyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 55433524) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is [3-(benzylcarbamoyl)phenyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | [3-(benzylcarbamoyl)phenyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 55433524 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [3-(benzylcarbamoyl)phenyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCCC(C(=O)Oc1cccc(C(=O)NCc2ccccc2)c1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C27H30N2O5S/c1-35-15-14-23(29-25(31)21-12-5-6-13-22(21)26(29)32)27(33)34-20-11-7-10-19(16-20)24(30)28-17-18-8-3-2-4-9-18/h2-4,7-11,16,21-23H,5-6,12-15,17H2,1H3,(H,28,30) |
| InChIKey | QGQDIMGRICVEMP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|