C12H8N4O2 — CID 107588970
4-amino-2-pyrimidin-5-ylisoindole-1,3-dione (PubChem CID 107588970) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 4-amino-2-pyrimidin-5-ylisoindole-1,3-dione.
| Compound Name | 4-amino-2-pyrimidin-5-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 107588970 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-amino-2-pyrimidin-5-ylisoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(c1cncnc1)C2=O |
| InChI | InChI=1S/C12H8N4O2/c13-9-3-1-2-8-10(9)12(18)16(11(8)17)7-4-14-6-15-5-7/h1-6H,13H2 |
| InChIKey | CJUVEWBFCJCKOT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|