C24H19FN2O4 — CID 9010901
[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl] (E)-3-phenylprop-2-enoate (PubChem CID 9010901) has the molecular formula C24H19FN2O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is [2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 9010901 |
| Molecular Formula | C24H19FN2O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1)Nc1ccccc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN2O4/c25-18-11-13-19(14-12-18)26-24(30)20-8-4-5-9-21(20)27-22(28)16-31-23(29)15-10-17-6-2-1-3-7-17/h1-15H,16H2,(H,26,30)(H,27,28)/b15-10+ |
| InChIKey | XKBGUKRLMLEWJK-XNTDXEJSSA-N |
| XLogP | 4.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|