C20H16F3NO5 — CID 7690170
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7690170) has the molecular formula C20H16F3NO5 and a molecular weight of 407.34 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7690170 |
| Molecular Formula | C20H16F3NO5 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3NO5/c1-28-16-5-3-2-4-15(16)19(27)24-17(25)12-29-18(26)11-8-13-6-9-14(10-7-13)20(21,22)23/h2-11H,12H2,1H3,(H,24,25,27)/b11-8+ |
| InChIKey | QMSVFDKBDNABKQ-DHZHZOJOSA-N |
| XLogP | 3.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|