C14H10F4N2O — CID 79883496
2-fluoro-N-(pyridin-3-ylmethyl)-3-(trifluoromethyl)benzamide (PubChem CID 79883496) has the molecular formula C14H10F4N2O and a molecular weight of 298.24 g/mol. Its IUPAC name is 2-fluoro-N-(pyridin-3-ylmethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(pyridin-3-ylmethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 79883496 |
| Molecular Formula | C14H10F4N2O |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-fluoro-N-(pyridin-3-ylmethyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1cccnc1)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C14H10F4N2O/c15-12-10(4-1-5-11(12)14(16,17)18)13(21)20-8-9-3-2-6-19-7-9/h1-7H,8H2,(H,20,21) |
| InChIKey | YZAKYIVUONTDAG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |