C11H9F3N4O — CID 47801296
N-(pyridin-3-ylmethyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxamide (PubChem CID 47801296) has the molecular formula C11H9F3N4O and a molecular weight of 270.21 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(pyridin-3-ylmethyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 47801296 |
| Molecular Formula | C11H9F3N4O |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1cn[nH]c1C(F)(F)F |
| InChI | InChI=1S/C11H9F3N4O/c12-11(13,14)9-8(6-17-18-9)10(19)16-5-7-2-1-3-15-4-7/h1-4,6H,5H2,(H,16,19)(H,17,18) |
| InChIKey | CTMGAFJLBBPEOJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |