C17H13N5O — CID 166322106
5-(3-cyanophenyl)-N-(pyridin-3-ylmethyl)-1H-pyrazole-4-carboxamide (PubChem CID 166322106) has the molecular formula C17H13N5O and a molecular weight of 303.33 g/mol. Its IUPAC name is 5-(3-cyanophenyl)-N-(pyridin-3-ylmethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-cyanophenyl)-N-(pyridin-3-ylmethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166322106 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-(3-cyanophenyl)-N-(pyridin-3-ylmethyl)-1H-pyrazole-4-carboxamide |
| SMILES | N#Cc1cccc(-c2[nH]ncc2C(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C17H13N5O/c18-8-12-3-1-5-14(7-12)16-15(11-21-22-16)17(23)20-10-13-4-2-6-19-9-13/h1-7,9,11H,10H2,(H,20,23)(H,21,22) |
| InChIKey | VOJLWUIHAGFHOB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |