C24H23N3O2 — CID 108976890
1-N'-benzyl-1-N'-phenyl-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976890) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-N'-benzyl-1-N'-phenyl-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-benzyl-1-N'-phenyl-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976890 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-N'-benzyl-1-N'-phenyl-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCc1cccnc1)C1(C(=O)N(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H23N3O2/c28-22(26-17-20-10-7-15-25-16-20)24(13-14-24)23(29)27(21-11-5-2-6-12-21)18-19-8-3-1-4-9-19/h1-12,15-16H,13-14,17-18H2,(H,26,28) |
| InChIKey | UCMKESJSGZTPFW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|